NH3 is an example of :

1. Electron rich hydride

2. Electron-precise hydride

3. Electron deficient hydride

4. None of the above

Subtopic:  Type of Hydride |
 77%
Level 2: 60%+
Hints

Incorrect statement regarding structure of H2O and H2O2 is:

1. In gaseous phase, water molecule has a bent form.

2. Bond angle of water is 109.0°

3. Hydrogen peroxide has a non-planar structure.

4. The dihedral angle of H2Oin gas phase is 111.5° 

Subtopic:  Water | H2O2 (Hydrogen Peroxide) |
 70%
Level 2: 60%+
Hints

The reaction that is not an example of a hydrolysis reaction is-

1. PbS(s)+H2O2(aq)PbSO4(s)+H2O(l)

2. CaO(s)+H2O(g)Ca(OH)2(aq)

3. AlCl3(g)+3H2O(l)Al2O3(s)+6HCl(aq)

4. Ca3N2(s)+6H2O(l)3Ca(OH)2(aq)+2NH3(g)

Subtopic:  Water |
 63%
Level 2: 60%+
Hints

The following reaction is an example of :

\(2 \mathrm{MnO}_4^{-}+6 \mathrm{H}^{+}+5 \mathrm{H}_2 \mathrm{O}_2 \rightarrow 2 \mathrm{Mn}^{2+}+8 \mathrm{H}_2 \mathrm{O}+5 \mathrm{O}_2\)

1. Hydrolysis reaction

2. Redox reaction

3. Disproportionation reaction

4. None of the above

Subtopic:  Preparation & Properties | H2O2 (Hydrogen Peroxide) |
 67%
Level 2: 60%+
Hints
Links

The reaction in which hydrogen peroxide acts as a reducing agent is/are-

1. Mn+2+H2O2Mn+4+2OH-

2. PbS+4H2O2PbSO4+4H2O

3. I2+H2O2+2OH-2I-+2H2O+O2

4. All of the above

Subtopic:  H2O2 (Hydrogen Peroxide) |
 65%
Level 2: 60%+
Hints

Hydrolysis and hydration are:

1. Different chemical process

2. Same chemical process

3. Can be used simultaneously

4. All of these

Subtopic:  Water |
 70%
Level 2: 60%+
Hints

The incorrect statement among the following options is:

1. K+ ions react with alkaline water and give K(OH)3

2. KCl is a salt of strong acid and strong base.

3. Al(OH)3 in alkaline condition gives [Al(OH)4]-

4. AlCl3 is a salt of strong acid and weak base.

Subtopic:  Hard & Soft Water |
 53%
Level 3: 35%-60%
Hints

True statement among the following options is/are:

1. NH3 is a covalent molecule.
2. The metals of d–block form metallic or non–stoichiometric hydrides.
3. Potassium hydride reacts violently with water.
4. All of these.

Subtopic:  Type of Hydride |
 90%
Level 1: 80%+
Hints

Incorrect statement among the following options is:

1. Hydrogen economy is a technique of using dihydrogen in an efficient way.
2. Ni is used as catalyst in hydrogenation of vegetable oil to give edible fats.
3. Syngas is a mixture of carbon monoxide and dihydrogen.
4. In a water gas shift reaction, CO will form as final product.

Subtopic:  Water |
 79%
Level 2: 60%+
Hints

The strength of 11.2 volume solution of H2O2 is :

[Given that molar mass of H = 1g mol–1 and O = 16g mol–1]

1. 1.7%

2. 34%

3. 3.4%

4. 13.6%

Subtopic:  H2O2 (Hydrogen Peroxide) |
 61%
Level 2: 60%+
JEE
Please attempt this question first.
Hints
Please attempt this question first.