Alkali metals are not found in nature in their elemental state because they are : 

1. Less reactive due to low ionization energies.

2. Highly reactive due to low ionization energies.

3. Highly reactive due to low electron gain enthalpy.

4. Less reactive due to low electron gain enthalpy.

Subtopic:  Chemical Properties |
 86%
Level 1: 80%+
Hints

The oxidation state of sodium in Na2O2 is -

1. +1

2. -1

3. 0

4. +2

Subtopic:  Physical Properties | Chemical Properties |
 72%
Level 2: 60%+
Hints
Links

Alkali and alkaline earth metals cannot be obtained by chemical reduction method because they are the strongest :

1. Oxidizing agents.

2. Reducing agents.

3. Hydrating agents.

4. Drying agents.

Subtopic:  Reasoning Questions |
 89%
Level 1: 80%+
Hints
Links

Beryllium and Magnesium do not impart color in flame test, because -

1. Be and Mg have high Ionization Energy.

2. Be and Mg have low Ionization Energy.

3. Be and Mg radiate energy in the Infra-Red region.

4. Be and Mg have a high radius.

Subtopic:  Physical Properties |
 73%
Level 2: 60%+
Hints
Links

The incorrect equation for Solvay process is -

1. Ca(OH)2+2NH4ClNH3+2H2O+CaCl2

2. 2NaHCO3Na2CO3+CO2+H2O

3. 2NaCl+CaCO3Na2CO3+CaCl2

4. None of the above.

Subtopic:  Compounds of Ca and Na -Preparations, Properties & Uses |
Level 3: 35%-60%
Hints
Links

Potassium carbonate cannot be prepared by the Solvay process because -

1. Potassium carbonate is insoluble in water and does not precipitate out.
2. Potassium carbonate is soluble in water and does not precipitate out.
3. Potassium carbonate is soluble in water and does precipitate out.
4. Potassium carbonate is insoluble in water and does precipitate out.

Subtopic:  Compounds of Ca and Na -Preparations, Properties & Uses |
 75%
Level 2: 60%+
Hints
Links

The hydroxides and carbonates of sodium and potassium are easily soluble in water while the corresponding salts of magnesium and calcium are sparingly soluble in water because -

1. Lattice energies of carbonates and hydroxides formed by calcium and magnesium are much more than those of sodium and potassium.

2. Lattice energies of carbonates and hydroxides formed by sodium and potassium are much more than those of calcium and magnesium.

3. Enthalpy of carbonates and hydroxides formed by calcium and magnesium are much more than those of sodium and potassium.

4. Enthalpy of carbonates and hydroxides formed by sodium and potassium are much more than those of calcium and magnesium.

Subtopic:  Reasoning Questions | Compounds of Ca and Na -Preparations, Properties & Uses |
 69%
Level 2: 60%+
Hints

Lithium salts are generally hydrated because they have :

1. High polarizing power.

2. High ionization enthalpy.

3. High electronegativity.

4. Low polarizing power.

Subtopic:  Physical Properties | Chemical Properties |
 74%
Level 2: 60%+
Hints
Links

LiF is almost insoluble in water whereas LiCl is soluble in water and acetone both, because of:

1. Greater covalent character of LiCl as compared to LiF.
2. Greater hydration energy of  LiF as compared to LiCl.
3. Greater size of LiF as compared to LiCl.
4. Greater lattice energy of LiF as compared to LiCl.

 

Subtopic:  Chemical Properties | Reasoning Questions |
 57%
Level 3: 35%-60%
Hints

The incorrect reaction among the following is:

1. Na2O2(s) + 2H2O(l) → 2NaOH(aq) + H2O2(g)
2. 2KO2(s) + 2H2O(l) → 2KOH(aq) + H2O2(aq) + O2(g)
3. Na2O(s) + CO2(g) → NaHCO3 (s) + H2O2(aq)
4. Na2O(s) + CO2(g) → Na2CO3 (s)

Subtopic:  Chemical Properties | Compounds of Ca and Na -Preparations, Properties & Uses |
 69%
Level 2: 60%+
Hints