The reaction 

can be classified as

1. Alcohol formation reaction

2. Dehydration reaction

3. Williamson alcohol synthesis reaction

4. Williamson ether synthesis reaction

अभिक्रिया

को किस रूप में वर्गीकृत किया जा सकता है?

1. एल्कोहॉल निर्माण अभिक्रिया

2. निर्जलीकरण अभिक्रिया

3. विलियमसन एल्कोहॉल संश्लेषण अभिक्रिया

4. विलियमसन ईथर संश्लेषण अभिक्रिया

Level 4: Below 35%
Hints

(CH3)3C-O-CH3 + HI Products, the product are

1. (CH3)3C-OH + CH3l

2. (CH3)3C-l + CH3OH

3. (CH3)3C-l + CH3l

4. (CH3)3C-OH + CH3OH

(CH3)3C-O-CH3 + HI उत्पाद, उत्पाद हैं:

1. (CH3)3C-OH + CH3l

2. (CH3)3C-l + CH3OH

3. (CH3)3C-l + CH3l

4. (CH3)3C-OH + CH3OH

Level 4: Below 35%
Hints

The main product of the following reaction is:

C6H5CH2CH(OH)CH(CH3)2Conc.H2SO4?

(1) 

(2) 

(3) 

(4)  

निम्नलिखित अभिक्रिया का मुख्य उत्पाद है:

C6H5CH2CH(OH)CH(CH3)2Conc.H2SO4?

(1) 

(2) 

(3) 

(4)  

 69%
Level 2: 60%+
Hints

Which of the following compounds are not oxidized by HIO4?

1. 5,6,7     

2. 4,5,6,7     

3. 6,7     

4. 3,4,5,6,7

निम्नलिखित में से कौन सा यौगिक HIO4 द्वारा ऑक्सीकृत नहीं होता है?

1. 5,6,7     

2. 4,5,6,7     

3. 6,7     

4. 3,4,5,6,7

 58%
Level 3: 35%-60%
Hints

Phenol is less soluble in water. It is due to:

1. non-polar nature of phenol

2. acidic nature of -OH group

3. non-polar hydrocarbon part in it

4. none of the above

फीनॉल जल में अल्प विलेय है। यह निम्न कारण से होता है-

1. फीनॉल की अध्रुवीय प्रकृति

2. -OH समूह की अम्लीय प्रकृति

3. इसमें अध्रुवीय हाइड्रोकार्बन भाग

4. उपरोक्त में से कोई नहीं

 56%
Level 3: 35%-60%
Hints

When phenol is treated with excess bromine water, it gives:

1. m-bromophenol

2. o- and p-bromophenol

3. 2,4-dibromophenol

4. 2,4,6-tribromophenol

जब फीनॉल को आधिक्य ब्रोमीन जल के साथ उपचारित किया जाता है, तो यह देता है:
1. m-ब्रोमोफीनॉल

2. o- और p-ब्रोमोफीनॉल

3. 2,4-डाइब्रोमोफीनॉल

4. 2,4,6-ट्राइब्रोमोफीनॉल

 56%
Level 3: 35%-60%
Hints

How many isomers of C5H11OH will be primary alcohols?

1. 5

2. 4

3. 2

4. 3

C5H11OH के कितने समावयवीं प्राथमिक एल्कोहॉल होंगे?

1. 5

2. 4

3. 2

4. 3

Level 3: 35%-60%
Hints

When phenol is reacted with chloroform and an alkali like NaOH, the compound formed is salicylaldehyde. If we use pyrene in place of chloroform the product obtained is:

(1) salicylaldehyde

(2) phenolphthalein

(3) salicylic acid

(4) cyclohexanol

जब फीनॉल, क्लोरोफॉर्म और NaOH जैसे क्षार के साथ अभिक्रिया करता है, तो यौगिक सैलिसैल्डिहाइड का निर्माण होता है। यदि हम क्लोरोफॉर्म के स्थान पर पाइरीन का उपयोग करते है तो निर्मित उत्पाद है:

1. सैलिसैल्डिहाइड

2. फीनॉलफ्थेलीन

3. सैलिसिलिक अम्ल

4. साइक्लोहेक्सेनॉल

Level 3: 35%-60%
Hints

Absolute alcohol is prepared from rectified spirit by:

(1) fractional distillation

(2) steam distillation

(3) azeotropic distillation

(4) vacuum distillation

परिशोधित स्प्रिट से परिशुद्ध एल्कोहॉल को कैसे तैयार किया जाता है?

(a) प्रभाजी आसवन                (b) भाप आसवन

(c) स्थिरक्वाथी आसवन             (d) निर्वात आसवन

Level 3: 35%-60%
Hints

Which of these is a reducing agent ?
1. CrO3/H+
2. KMnO4
3. LiAlH4
4. O3

इनमें से कौन सा एक अपचायक है?
1. CrO3/H+
2. KMnO4
3. LiAlH4
4. O3

 67%
Level 2: 60%+
Hints