The number of chiral carbon atoms in the given compound is are :



1. 2

2. 3

3. 4

4. 1

Subtopic:  Stereo Isomers |
 82%
Level 1: 80%+
Hints

In the following reaction, 

CH3CHO+HCNCH3CH(OH)CNH+/H2OCH3CH(OH)COOH

an asymmetric center is generated. The acid obtained would be

1. L-isomer
2. D-isomer
3. 20% D+ 80% L-isomer
4. 50% D+ 50 % L-isomer

Subtopic:  Isomers & Reaction Mechanism |
 74%
Level 2: 60%+
Hints

In which of the following sets, from left to right, is the hybridization sequence sp²-sp²-sp-sp applicable?

1. \(\mathrm{CH}_2=\mathrm{CH}-\mathrm{C} \equiv \mathrm{CH}\)
2. \(\mathrm{CH} \equiv \mathrm{C}-\mathrm{C} \equiv \mathrm{N}\)
3. \(\mathrm{CH}_2=\mathrm{C}=\mathrm{C}=\mathrm{CH}_2\)
4.
Subtopic:  Hybridisation & Structure of Carbon Compounds |
 90%
Level 1: 80%+
Hints

The hydrocarbons having the lowest dipole moment among the following is:

1. 2. CH3 - C ≡ C - CH3
3. CH3 CH2 CH = CH2 4. CH2 = CH - C ≡ CH
Subtopic:  Aromaticity & Polarity |
 70%
Level 2: 60%+
Hints

What is the hybridization type of the \(\mathrm{C}_{4}- \mathrm{C}_5\) bond in the compound CH 2=CH-CH2-CH2-C≡CH?

1. sp-sp2
2. sp3-sp
3. sp-sp3
4. sp2-sp3

Subtopic:  Hybridisation & Structure of Carbon Compounds |
Level 3: 35%-60%
Hints

An organic compound C4H8O is found to be optically active. Which of the following is the correct structure of the given compound?

1. (CH3)2CHCHO

2. CH2=CHCH(OH)CH3

3. CH3COCH2CH3

4. CH3CH2CH2CHO

Subtopic:  Stereo Isomers |
 81%
Level 1: 80%+
Hints

How many optical isomers are formed by the hydrogenation of the compound \((CH_3)_2C=CHCH_3\)?

1. 0
2. 1
3. 2
4. 3

Subtopic:  Stereo Isomers |
 71%
Level 2: 60%+
Hints

What is the number and type of bonds between the two carbon atoms in CaC₂?

1. One sigma and one π bond

2. One sigma and two π bonds

3. One sigma and one and a half π bond

4. One sigma bond

Subtopic:  Types of Chemical Bond |
 73%
Level 2: 60%+
Hints

Which of the following has the least hindered rotation about carbon-carbon bond?

1. Ethane

2. Ethylene

3. Acetylene

4. Hexachloroethane

Subtopic:  Hybridisation & Structure of Carbon Compounds |
 69%
Level 2: 60%+
Hints

The Cl — C — Cl angles in 1,1,2,2-tetrachloroethene and tetrachloromethane will be about :

1. 120° and 109.5°

2. 90° and 109.5°

3. 109.5° and 90°

4. 109.5° and 120°

Subtopic:  Hybridisation & Structure of Carbon Compounds |
 63%
Level 2: 60%+
Hints