The correct statement among the following about the structural isomers of C5H11Br is:

1. It has a total of 8 structural isomers, 4 are primary alkyl bromide isomers and 2 are tertiary alkyl bromide isomers.
2. It has a total of 7 structural isomers, 4 are primary alkyl bromide isomers and 2 are tertiary alkyl bromide isomers.
3. It has a total of 8 structural isomers, 4 are primary alkyl bromide isomers and 3 are secondary alkyl bromide isomers.
4. It has a total of 7 structural isomers, 3 are secondary alkyl bromide isomers and 1 is a tertiary alkyl bromide isomer.
Subtopic:  Isomerism & Chirality |
 56%
Level 3: 35%-60%
Hints

Match the items in column I with the column II.

Column I: Structures Column II: IUPAC name
a. i. 4-Bromo- 3-methylpent-2-ene
b.  ii. 3-Bromo-2-methylpropene
c. iii.  1-Bromo-2-methylbut-2-ene
d. iv. 4-Bromopent-2-ene

   
1. a=iii; b=iv; c=i; d=ii
2. a=ii; b=iv; c=i; d=iii
3. a=iv; b=i; c=ii; d=iii
4. a=iv; b=ii, c=iv; d=iii

Subtopic:  Introduction and Physical Properties |
 83%
Level 1: 80%+
Hints

The number of monochloro structural isomers formed on free radical monochlorination of (CH3)2CHCH2CH3 is:
1. 5
2. 3
3. 4
4. 6

Subtopic:  Chemical Properties | Isomerism & Chirality |
 67%
Level 2: 60%+
Hints

Consider the following reaction:

What is the major product A?

1. 2.  
3. 4. None of the above
Subtopic:  Chemical Properties |
 86%
Level 1: 80%+
Hints

Consider the following reaction.
The product A and B are respectively:
1. A= R-CH2-CN; B= R-CH2-NC
2. A= R-CH2-NC; B= R-CH2-CN
3. A= R-NCH-CH3; B= R-CH2-CN
4. A= R-CH2-NC; B= R-CHN-CH3

Subtopic:  Chemical Properties |
 93%
Level 1: 80%+
Hints

In the following pairs of halogen compounds, the pair that would undergo SN2 reaction faster:

1.
2.
3.
4.
Subtopic:  Chemical Properties |
 78%
Level 2: 60%+
Hints

Correct statement among the following is:

a. For SN2 reactivity order is CH3CH2CH2CH2Br(CH3)2CHCH2Br > CH3CH2CH(Br)CH3 > (CH3)3CBr
b. For SN1 reactivity order is (CH3)3CBr > CH3CH2CH(Br)CH3 >CH3CH2CH2CH2Br >(CH3)2CHCH2Br
c. For SN1 reactivity order is C6H5CH2Br < C6H5CH(CH3)Br < C6H5CH(C6H5)Br< C6H5C(CH3)(C6H5)Br
d. For SN2 reactivity order is C6H5CH2Br > C6H5CH(CH3)Br > C6H5CH(C6H5)Br > C6H5C(CH3)(C6H5)Br

The correct statement(s) is/are-
1.
a, b
2.
b, c
3.
a, c, d
4. b, d

Subtopic:  Chemical Properties |
 62%
Level 2: 60%+
Hints

The incorrect matches among the following are:

a.  
b.  
c.
d.  
 
1. a, b 2. b, c, d
3. c, d 4. c, b

Subtopic:  Isomerism & Chirality |
 79%
Level 2: 60%+
Hints

Given below are two statements: 
 
Assertion (A): chlorine is an electron-withdrawing group, yet it is ortho-, para- directing in electrophilic aromatic substitution reactions.
Reason (R): Halogen atom is a ring deactivator.

1. Both (A) and (R) are true and (R) is the correct explanation of (A).
2. Both (A) and (R) are true but (R) is not the correct explanation of (A).
3. (A) is true but (R) is false.
4. (A) is false but (R) is true.
 

 

Subtopic:  Haloarenes: Directive Influence of Halogen |
 56%
Level 3: 35%-60%
Hints

Consider the following reaction.
\(CH_3-CH_2-CH=CH_2+HCl\longrightarrow A\)
The product A is:
1. 2-Chloropropane
2. 2-Chlorobutane
3. 1-Chlorobutane
4. 3-chloropropane
Subtopic:  Introduction and Physical Properties |
 87%
Level 1: 80%+
Hints