The correct order of increasing reducing nature is -

1. NaH > H2O < MgH2

2. H2O > MgH2> NaH

3. H2O< MgH2 < NaH

4. H2O  MgH2 < NaH

Subtopic:  Type of Hydride |
 54%
Level 3: 35%-60%
Hints

The products obtained on the completion of the following reactions (i) and (ii) respectively are :

i. C3H8(g) + 3H2O(g) \(\xrightarrow[Catalyst]{\Delta}\) A
ii. \(\mathrm{Zn}_{(s)}+\mathrm{NaOH}_{(\mathrm{aq})} \xrightarrow[]{Heat}\)B


1. A = CO, and H2 ; B = Na2ZnO2
2. A  = CO2 ; B = Na4ZnO4
3. A = CH3CH2CH2OH ; B=  ZnO
4. None of the above


 

 

Subtopic:  Preparation & Properties |
 77%
Level 2: 60%+
Hints
Links

“Non-stoichiometric hydrides” are :

1. Hydrogen-deficient compounds formed by the reaction of a hydrogen atom with d-block and f-block elements.
2. Hydrogen-deficient compounds formed by the reaction of dihydrogen with d-block and f-block elements.
3. Electron-deficient compounds formed by the reaction of dihydrogen with d-block and f-block elements.
4. Hydrogen-deficient compounds formed by the reaction of dihydrogen with s-block and p-block elements.

Subtopic:  Type of Hydride |
 51%
Level 3: 35%-60%
Hints
Links

Hydrogen is placed separately in the periodic table because : 

1. It resembles alkali metals.

2. It shows the same reactions as halogens.

3. Both (1) and (2)

4. None of the above.

Subtopic:  Hydrogen- Types & Isotopes |
 92%
Level 1: 80%+
Hints
Links

The following reaction is an example of :

\(2 \mathrm{MnO}_4^{-}+6 \mathrm{H}^{+}+5 \mathrm{H}_2 \mathrm{O}_2 \rightarrow 2 \mathrm{Mn}^{2+}+8 \mathrm{H}_2 \mathrm{O}+5 \mathrm{O}_2\)

1. Hydrolysis reaction

2. Redox reaction

3. Disproportionation reaction

4. None of the above

Subtopic:  Preparation & Properties | H2O2 (Hydrogen Peroxide) |
 67%
Level 2: 60%+
Hints
Links

The correct order of increasing electrical conductance is -
1. BeH2 > CaH2 > TiH2
2. BeH2 < CaH2 > TiH2
3. TiH2 < BeH2 < CaH2
4. BeH2 < CaH2 < TiH2

Subtopic:  Type of Hydride |
Level 3: 35%-60%
Hints

The isotopes of hydrogen and their mass ratio are -

1. Protium, Deuterium, Tritium ; 3:2:3

2. Protium, Deuterium, Tritium ; 1:2:3

3. Protium, Deuterium, Tritium ; 2:2:3

4. Protium, Deuterium, Tritium ; 3:2:1

Subtopic:  Hydrogen- Types & Isotopes |
 93%
Level 1: 80%+
Hints
Links

The consequences of high enthalpy of H–H bond in dihydrogen is /are :

1. Hydrogen has a low tendency to form H+ions.
2. It forms diatomic molecules (H2), and a large number of covalent hydrides.
3. Hydrogen does not possess metallic characteristics.
4. All of the above.

Subtopic:  Hydrogen- Types & Isotopes |
 80%
Level 1: 80%+
Hints

Metallic hydrides are useful for hydrogen storage because : 

1. Metallic hydrides are oxygen-rich.

2. Metallic hydrides are oxygen-deficient.

3. Metallic hydrides are hydrogen-rich.

4. Metallic hydrides are hydrogen-deficient.

Subtopic:  Type of Hydride |
 54%
Level 3: 35%-60%
Hints
Links

The reaction that is not an example of a hydrolysis reaction is-

1. PbS(s)+H2O2(aq)PbSO4(s)+H2O(l)

2. CaO(s)+H2O(g)Ca(OH)2(aq)

3. AlCl3(g)+3H2O(l)Al2O3(s)+6HCl(aq)

4. Ca3N2(s)+6H2O(l)3Ca(OH)2(aq)+2NH3(g)

Subtopic:  Water |
 63%
Level 2: 60%+
Hints