The reaction that is not an example of a hydrolysis reaction is-

1. PbS(s)+H2O2(aq)PbSO4(s)+H2O(l)

2. CaO(s)+H2O(g)Ca(OH)2(aq)

3. AlCl3(g)+3H2O(l)Al2O3(s)+6HCl(aq)

4. Ca3N2(s)+6H2O(l)3Ca(OH)2(aq)+2NH3(g)

Subtopic:  Water |
 63%
Level 2: 60%+
Hints

The structure of the common form of ice is :

1. Each hydrogen atom is surrounded tetrahedrally by four other oxygen atoms at a distance of 540 pm.
2. Each hydrogen atom is surrounded tetrahedrally by four other oxygen atoms at a distance of 276 pm.
3. Each oxygen atom is surrounded tetrahedrally by four other oxygen atoms at a distance of 276 pm.
4. Each oxygen atom is surrounded tetrahedrally by four other oxygen atoms at a distance of 540 pm.

Subtopic:  Water |
 58%
Level 3: 35%-60%
Hints

Incorrect statement regarding structure of H2O and H2O2 is:

1. In gaseous phase, water molecule has a bent form.

2. Bond angle of water is 109.0°

3. Hydrogen peroxide has a non-planar structure.

4. The dihedral angle of H2Oin gas phase is 111.5° 

Subtopic:  Water | H2O2 (Hydrogen Peroxide) |
 70%
Level 2: 60%+
Hints

 The correct order of hydrogen bonding among NH3, H2O and HF, is 

1. HF > H2O > NH3

2. H2O > HF > NH3

3. HF > NH3 > H2O

4. NH3 > HF > H2O

Subtopic:  Type of Hydride | Water |
Level 3: 35%-60%
Hints

The term ’auto-protolysis’ of water means :

1. Physical reaction in which two water molecules react to produce a hydroxide ion (OH) and a hydronium ion (H3O+).
2. Chemical reaction in which five water molecules react to produce a hydroxide ion (OH) and a hydronium ion (H3O+).
3. Chemical reaction in which two water molecules react to produce a hydroxide ion (OH) and a hydronium ion (H3O+).
4. Chemical reaction in which two water molecules react to produce three hydroxide ions (OH)

Subtopic:  Water |
 73%
Level 2: 60%+
Hints

The correct statement about the reaction of water with fluorine is:

1. O is reduced from 0 to -1 oxidation state, whereas F is oxidized from –2 to 0
2. F is reduced from 0  to -1 oxidation state, whereas O is oxidized from –2 to 0
3. F is reduced from 0 to –2 oxidation state, whereas O is oxidized from – 2 to -1
4. O is reduced from 0 to –2 oxidation state, whereas F is oxidized from –3 to 0

Subtopic:  Water |
 79%
Level 2: 60%+
Hints

Water acts as a base in -

1. Reaction with H2S

2. Reaction with NH3

3. Reaction with NaOH

4. All of the above

Subtopic:  Water |
 61%
Level 2: 60%+
Hints

‘Demineralised’ water can be obtained by :

1. Passing water successively through an anion exchange (in the K+ form) and cation exchange (in the Mn- form) resin
2. Passing water successively through a cation exchange (in the H+ form) and an anion exchange (in the OH- form) resin
3. Passing water successively through an anion exchange (in the O+ form) and cation exchange (in the OH- form) resin
4. Passing water successively through a cation exchange (in the OH- form) and an anion exchange (in the H+ form) resin

Subtopic:  Water |
 74%
Level 2: 60%+
Hints

Demineralized or distilled water is not useful for drinking purposes because -

1. Demineralised water contains all insoluble minerals. 

2. Demineralised water is free of all soluble minerals. 

3. Demineralised water contains soluble minerals. 

4. Demineralised water contains soluble anion only.

Subtopic:  Water |
 73%
Level 2: 60%+
Hints

Water is important in the biosphere and biological systems because :

1. It constitutes around 65% of the human body and 95% of plants
2. It acts as a carrier of various nutrients required by plants and animals for various metabolic reactions.
3. The high heat of vaporization and heat of capacity of water helps in moderating the climate and body temperature of all living beings
4. All of the above.

Subtopic:  Water |
 91%
Level 1: 80%+
Hints