The incorrect statement about alkali metals is -

1. They have low density.

2. They have high ionization enthalpy.

3. They are highly reactive.

4. They show photoelectric effect.

Subtopic:  Physical Properties |
 72%
Level 2: 60%+
Hints

Sodium is less reactive than potassium because-

1. Potassium loses electron easily.

2. Sodium loses electron easily.

3. Size of sodium is larger than potassium.

4. Nuclear charge is more on potassium.

Subtopic:  Chemical Properties |
 70%
Level 2: 60%+
Hints

Beryllium and Magnesium do not impart color in flame test, because -

1. Be and Mg have high Ionization Energy.

2. Be and Mg have low Ionization Energy.

3. Be and Mg radiate energy in the Infra-Red region.

4. Be and Mg have a high radius.

Subtopic:  Physical Properties |
 73%
Level 2: 60%+
Hints
Links

LiF is almost insoluble in water whereas LiCl is soluble in water and acetone both, because of:

1. Greater covalent character of LiCl as compared to LiF.
2. Greater hydration energy of  LiF as compared to LiCl.
3. Greater size of LiF as compared to LiCl.
4. Greater lattice energy of LiF as compared to LiCl.

 

Subtopic:  Chemical Properties | Reasoning Questions |
 57%
Level 3: 35%-60%
Hints

Sodium hydroxide can be prepared by:

1. Down's Process.

2. Castner–Kellner process.

3. Solvay's Process.

4. None of the above.

Subtopic:  Chemical Properties | Preparations, Properties & Uses of S Block Elements |
 77%
Level 2: 60%+
Hints
Links

The characteristic of alkaline earth metals is that-

1. Their general oxidation state is +1

2. They have a smaller size than alkali metals.

3. They are electronegative in nature.

4. They are strong oxidizing agents.

Subtopic:  Chemical Properties |
 79%
Level 2: 60%+
Hints

The incorrect equation for Solvay process is -

1. Ca(OH)2+2NH4ClNH3+2H2O+CaCl2

2. 2NaHCO3Na2CO3+CO2+H2O

3. 2NaCl+CaCO3Na2CO3+CaCl2

4. None of the above.

Subtopic:  Compounds of Ca and Na -Preparations, Properties & Uses |
Level 3: 35%-60%
Hints
Links

The incorrect statement among the following is-

1. Ionisation enthalpy of alkaline earth metals is higher than alkali metals.
2. Alkaline earth metal oxides are more basic than alkali metal oxides.
3. Alkaline earth metal hydroxides are less basic and less stable than alkali metal hydroxides.
4. Solubility of Alkaline earth metals and alkali metal hydroxide increases down the group.

Subtopic:  Physical Properties |
 70%
Level 2: 60%+
Hints

Quick lime is heated with silica to give:

1. CaSiO3

2. CaSiO4

3. CaSiO

4. Ca(SiO)3

Subtopic:  Compounds of Ca and Na -Preparations, Properties & Uses |
 66%
Level 2: 60%+
Hints
Links

Match the following:

Element Biological Significance
(a) Sodium (i) Oxidation of glucose to produce ATP.
(b) Potassium  (ii) Helps in transporting sugars and amino acids into the cells.
(c) Magnesium (iii) Helps in the coagulation of blood.
(d) Calcium (iv) Helps in building and strengthening bones.
 
(a) (b) (c) (d)
1. (ii) (i) (iv) (iii)
2. (i) (ii) (iii) (iv)
3. (iv) (ii) (i) (iii)
4. (iii) (i) (iv) (iii)
Subtopic:  Biological Importance of S Block Elements and & Its Ore |
Level 3: 35%-60%
Hints
Links